C19H23NO4 — CID 101126045
benzyl (2R)-2-(5-methyl-2-oxo-3H-furan-3-yl)azepane-1-carboxylate (PubChem CID 101126045) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is benzyl (2R)-2-(5-methyl-2-oxo-3H-furan-3-yl)azepane-1-carboxylate.
| Compound Name | benzyl (2R)-2-(5-methyl-2-oxo-3H-furan-3-yl)azepane-1-carboxylate |
|---|---|
| PubChem CID | 101126045 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | benzyl (2R)-2-(5-methyl-2-oxo-3H-furan-3-yl)azepane-1-carboxylate |
| SMILES | CC1=CC([C@H]2CCCCCN2C(=O)OCc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C19H23NO4/c1-14-12-16(18(21)24-14)17-10-6-3-7-11-20(17)19(22)23-13-15-8-4-2-5-9-15/h2,4-5,8-9,12,16-17H,3,6-7,10-11,13H2,1H3/t16?,17-/m1/s1 |
| InChIKey | NAMNQVWTWHWCKN-ZYMOGRSISA-N |
| XLogP | 3.64 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |