C22H20N6OS — CID 10112610
4-[[4-(5-methyl-3-methylsulfanyl-1-phenylpyrazol-4-yl)pyrimidin-2-yl]amino]benzamide (PubChem CID 10112610) has the molecular formula C22H20N6OS and a molecular weight of 416.51 g/mol. Its IUPAC name is 4-[[4-(5-methyl-3-methylsulfanyl-1-phenylpyrazol-4-yl)pyrimidin-2-yl]amino]benzamide.
| Compound Name | 4-[[4-(5-methyl-3-methylsulfanyl-1-phenylpyrazol-4-yl)pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 10112610 |
| Molecular Formula | C22H20N6OS |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 4-[[4-(5-methyl-3-methylsulfanyl-1-phenylpyrazol-4-yl)pyrimidin-2-yl]amino]benzamide |
| SMILES | CSc1nn(-c2ccccc2)c(C)c1-c1ccnc(Nc2ccc(C(N)=O)cc2)n1 |
| InChI | InChI=1S/C22H20N6OS/c1-14-19(21(30-2)27-28(14)17-6-4-3-5-7-17)18-12-13-24-22(26-18)25-16-10-8-15(9-11-16)20(23)29/h3-13H,1-2H3,(H2,23,29)(H,24,25,26) |
| InChIKey | KDRXFUMICNXLHC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |