C20H15N5O2 — CID 10291841
4-[[4-(2-phenylpyrazol-3-yl)pyrimidin-2-yl]amino]benzoic acid (PubChem CID 10291841) has the molecular formula C20H15N5O2 and a molecular weight of 357.37 g/mol. Its IUPAC name is 4-[[4-(2-phenylpyrazol-3-yl)pyrimidin-2-yl]amino]benzoic acid.
| Compound Name | 4-[[4-(2-phenylpyrazol-3-yl)pyrimidin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 10291841 |
| Molecular Formula | C20H15N5O2 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 4-[[4-(2-phenylpyrazol-3-yl)pyrimidin-2-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2nccc(-c3ccnn3-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H15N5O2/c26-19(27)14-6-8-15(9-7-14)23-20-21-12-10-17(24-20)18-11-13-22-25(18)16-4-2-1-3-5-16/h1-13H,(H,26,27)(H,21,23,24) |
| InChIKey | WSBFTLUNENPFPN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |