C11H7Cl2F3N2O2 — CID 101126842
4-chloro-5-(4-chloro-2-fluoro-5-methoxyphenyl)-3-(difluoromethoxy)-1H-pyrazole (PubChem CID 101126842) has the molecular formula C11H7Cl2F3N2O2 and a molecular weight of 327.09 g/mol. Its IUPAC name is 4-chloro-5-(4-chloro-2-fluoro-5-methoxyphenyl)-3-(difluoromethoxy)-1H-pyrazole.
| Compound Name | 4-chloro-5-(4-chloro-2-fluoro-5-methoxyphenyl)-3-(difluoromethoxy)-1H-pyrazole |
|---|---|
| PubChem CID | 101126842 |
| Molecular Formula | C11H7Cl2F3N2O2 |
| Molecular Weight | 327.09 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | 4-chloro-5-(4-chloro-2-fluoro-5-methoxyphenyl)-3-(difluoromethoxy)-1H-pyrazole |
| SMILES | COc1cc(-c2[nH]nc(OC(F)F)c2Cl)c(F)cc1Cl |
| InChI | InChI=1S/C11H7Cl2F3N2O2/c1-19-7-2-4(6(14)3-5(7)12)9-8(13)10(18-17-9)20-11(15)16/h2-3,11H,1H3,(H,17,18) |
| InChIKey | ISTZQVQBVGIQSZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.09 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |