C60H42O4P2 — CID 101127020
[(12R,13R)-13-(2-diphenylphosphanylbenzoyl)oxy-12-pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,9,15,17,19,21-decaenyl] 2-diphenylphosphanylbenzoate (PubChem CID 101127020) has the molecular formula C60H42O4P2 and a molecular weight of 888.94 g/mol. Its IUPAC name is [(12R,13R)-13-(2-diphenylphosphanylbenzoyl)oxy-12-pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,9,15,17,19,21-decaenyl] 2-diphenylphosphanylbenzoate.
| Compound Name | [(12R,13R)-13-(2-diphenylphosphanylbenzoyl)oxy-12-pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,9,15,17,19,21-decaenyl] 2-diphenylphosphanylbenzoate |
|---|---|
| PubChem CID | 101127020 |
| Molecular Formula | C60H42O4P2 |
| Molecular Weight | 888.94 g/mol |
| Exact Mass | 888.26 |
| IUPAC Name | [(12R,13R)-13-(2-diphenylphosphanylbenzoyl)oxy-12-pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,9,15,17,19,21-decaenyl] 2-diphenylphosphanylbenzoate |
| SMILES | O=C(O[C@@H]1c2ccc3ccccc3c2-c2c(ccc3ccccc23)[C@H]1OC(=O)c1ccccc1P(c1ccccc1)c1ccccc1)c1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C60H42O4P2/c61-59(49-33-17-19-35-53(49)65(43-23-5-1-6-24-43)44-25-7-2-8-26-44)63-57-51-39-37-41-21-13-15-31-47(41)55(51)56-48-32-16-14-22-42(48)38-40-52(56)58(57)64-60(62)50-34-18-20-36-54(50)66(45-27-9-3-10-28-45)46-29-11-4-12-30-46/h1-40,57-58H/t57-,58-/m1/s1 |
| InChIKey | CRTMVUQWENZGRA-YZCGSYMESA-N |
| XLogP | 11.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.94 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|