C25H25O3P — CID 16680405
(3,3-dimethyl-4-oxobutyl) 2-diphenylphosphanylbenzoate (PubChem CID 16680405) has the molecular formula C25H25O3P and a molecular weight of 404.45 g/mol. Its IUPAC name is (3,3-dimethyl-4-oxobutyl) 2-diphenylphosphanylbenzoate.
| Compound Name | (3,3-dimethyl-4-oxobutyl) 2-diphenylphosphanylbenzoate |
|---|---|
| PubChem CID | 16680405 |
| Molecular Formula | C25H25O3P |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | (3,3-dimethyl-4-oxobutyl) 2-diphenylphosphanylbenzoate |
| SMILES | CC(C)(C=O)CCOC(=O)c1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25O3P/c1-25(2,19-26)17-18-28-24(27)22-15-9-10-16-23(22)29(20-11-5-3-6-12-20)21-13-7-4-8-14-21/h3-16,19H,17-18H2,1-2H3 |
| InChIKey | DWMMBWPIQPYGJP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|