About [(3R)-hex-4-en-3-yl] 2-diphenylphosphanylbenzoate
[(3R)-hex-4-en-3-yl] 2-diphenylphosphanylbenzoate (PubChem CID 173037615) has the molecular formula C25H25O2P
and a molecular weight of 388.45 g/mol. Its IUPAC name is [(3R)-hex-4-en-3-yl] 2-diphenylphosphanylbenzoate.
Molecular Properties
| Compound Name | [(3R)-hex-4-en-3-yl] 2-diphenylphosphanylbenzoate |
| PubChem CID | 173037615 |
| Molecular Formula | C25H25O2P |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | [(3R)-hex-4-en-3-yl] 2-diphenylphosphanylbenzoate |
| SMILES | CC=C[C@@H](CC)OC(=O)c1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25O2P/c1-3-13-20(4-2)27-25(26)23-18-11-12-19-24(23)28(21-14-7-5-8-15-21)22-16-9-6-10-17-22/h3,5-20H,4H2,1-2H3/t20-/m1/s1 |
| InChIKey | FVLYAVQLCIHKQH-HXUWFJFHSA-N |
| XLogP | 4.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-hex-4-en-3-yl] 2-diphenylphosphanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-hex-4-en-3-yl] 2-diphenylphosphanylbenzoate?
The IUPAC name of [(3R)-hex-4-en-3-yl] 2-diphenylphosphanylbenzoate (CID 173037615) is [(3R)-hex-4-en-3-yl] 2-diphenylphosphanylbenzoate.
What is the SMILES notation for [(3R)-hex-4-en-3-yl] 2-diphenylphosphanylbenzoate?
The canonical SMILES for [(3R)-hex-4-en-3-yl] 2-diphenylphosphanylbenzoate is CC=C[C@@H](CC)OC(=O)c1ccccc1P(c1ccccc1)c1ccccc1.
What is the InChIKey of [(3R)-hex-4-en-3-yl] 2-diphenylphosphanylbenzoate?
The InChIKey is FVLYAVQLCIHKQH-HXUWFJFHSA-N. The full InChI is InChI=1S/C25H25O2P/c1-3-13-20(4-2)27-25(26)23-18-11-12-19-24(23)28(21-14-7-5-8-15-21)22-16-9-6-10-17-22/h3,5-20H,4H2,1-2H3/t20-/m1/s1.
What are the key properties of [(3R)-hex-4-en-3-yl] 2-diphenylphosphanylbenzoate?
[(3R)-hex-4-en-3-yl] 2-diphenylphosphanylbenzoate has a molecular weight of 388.45 g/mol, XLogP of 4.96, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-hex-4-en-3-yl] 2-diphenylphosphanylbenzoate is sourced from PubChem (CID 173037615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).