C28H31O2P — CID 10550577
[(3R,4S)-2,4,5-trimethylhex-5-en-3-yl] 2-diphenylphosphanylbenzoate (PubChem CID 10550577) has the molecular formula C28H31O2P and a molecular weight of 430.53 g/mol. Its IUPAC name is [(3R,4S)-2,4,5-trimethylhex-5-en-3-yl] 2-diphenylphosphanylbenzoate.
| Compound Name | [(3R,4S)-2,4,5-trimethylhex-5-en-3-yl] 2-diphenylphosphanylbenzoate |
|---|---|
| PubChem CID | 10550577 |
| Molecular Formula | C28H31O2P |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | [(3R,4S)-2,4,5-trimethylhex-5-en-3-yl] 2-diphenylphosphanylbenzoate |
| SMILES | C=C(C)[C@H](C)[C@H](OC(=O)c1ccccc1P(c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C28H31O2P/c1-20(2)22(5)27(21(3)4)30-28(29)25-18-12-13-19-26(25)31(23-14-8-6-9-15-23)24-16-10-7-11-17-24/h6-19,21-22,27H,1H2,2-5H3/t22-,27+/m0/s1 |
| InChIKey | ZZWINERKQHHPTJ-WXVAWEFUSA-N |
| XLogP | 5.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|