C35H35O4P — CID 101112052
[(1S,2R)-5-acetyl-2-methyl-6-oxo-1-phenylheptyl] 2-diphenylphosphanylbenzoate (PubChem CID 101112052) has the molecular formula C35H35O4P and a molecular weight of 550.64 g/mol. Its IUPAC name is [(1S,2R)-5-acetyl-2-methyl-6-oxo-1-phenylheptyl] 2-diphenylphosphanylbenzoate.
| Compound Name | [(1S,2R)-5-acetyl-2-methyl-6-oxo-1-phenylheptyl] 2-diphenylphosphanylbenzoate |
|---|---|
| PubChem CID | 101112052 |
| Molecular Formula | C35H35O4P |
| Molecular Weight | 550.64 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | [(1S,2R)-5-acetyl-2-methyl-6-oxo-1-phenylheptyl] 2-diphenylphosphanylbenzoate |
| SMILES | CC(=O)C(CC[C@@H](C)[C@H](OC(=O)c1ccccc1P(c1ccccc1)c1ccccc1)c1ccccc1)C(C)=O |
| InChI | InChI=1S/C35H35O4P/c1-25(23-24-31(26(2)36)27(3)37)34(28-15-7-4-8-16-28)39-35(38)32-21-13-14-22-33(32)40(29-17-9-5-10-18-29)30-19-11-6-12-20-30/h4-22,25,31,34H,23-24H2,1-3H3/t25-,34+/m1/s1 |
| InChIKey | GFOLNOFMISAUPI-GZGVDWRWSA-N |
| XLogP | 6.55 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.64 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|