C50H49O5P — CID 15856692
[(E,2R,3S,4R)-8-ethoxy-2,4-dimethyl-8-oxo-1-trityloxyoct-6-en-3-yl] 2-diphenylphosphanylbenzoate (PubChem CID 15856692) has the molecular formula C50H49O5P and a molecular weight of 760.91 g/mol. Its IUPAC name is [(E,2R,3S,4R)-8-ethoxy-2,4-dimethyl-8-oxo-1-trityloxyoct-6-en-3-yl] 2-diphenylphosphanylbenzoate.
| Compound Name | [(E,2R,3S,4R)-8-ethoxy-2,4-dimethyl-8-oxo-1-trityloxyoct-6-en-3-yl] 2-diphenylphosphanylbenzoate |
|---|---|
| PubChem CID | 15856692 |
| Molecular Formula | C50H49O5P |
| Molecular Weight | 760.91 g/mol |
| Exact Mass | 760.33 |
| IUPAC Name | [(E,2R,3S,4R)-8-ethoxy-2,4-dimethyl-8-oxo-1-trityloxyoct-6-en-3-yl] 2-diphenylphosphanylbenzoate |
| SMILES | CCOC(=O)/C=C/C[C@@H](C)[C@H](OC(=O)c1ccccc1P(c1ccccc1)c1ccccc1)[C@H](C)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C50H49O5P/c1-4-53-47(51)36-22-23-38(2)48(55-49(52)45-34-20-21-35-46(45)56(43-30-16-8-17-31-43)44-32-18-9-19-33-44)39(3)37-54-50(40-24-10-5-11-25-40,41-26-12-6-13-27-41)42-28-14-7-15-29-42/h5-22,24-36,38-39,48H,4,23,37H2,1-3H3/b36-22+/t38-,39-,48+/m1/s1 |
| InChIKey | BAWABNRVGQLFSP-LOERLZEUSA-N |
| XLogP | 9.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.91 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|