C30H33O3P — CID 10917707
[(E,5S,7S)-4,7-dimethyl-9-oxonon-3-en-5-yl] 2-diphenylphosphanylbenzoate (PubChem CID 10917707) has the molecular formula C30H33O3P and a molecular weight of 472.57 g/mol. Its IUPAC name is [(E,5S,7S)-4,7-dimethyl-9-oxonon-3-en-5-yl] 2-diphenylphosphanylbenzoate.
| Compound Name | [(E,5S,7S)-4,7-dimethyl-9-oxonon-3-en-5-yl] 2-diphenylphosphanylbenzoate |
|---|---|
| PubChem CID | 10917707 |
| Molecular Formula | C30H33O3P |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | [(E,5S,7S)-4,7-dimethyl-9-oxonon-3-en-5-yl] 2-diphenylphosphanylbenzoate |
| SMILES | CC/C=C(\C)[C@H](C[C@H](C)CC=O)OC(=O)c1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H33O3P/c1-4-13-24(3)28(22-23(2)20-21-31)33-30(32)27-18-11-12-19-29(27)34(25-14-7-5-8-15-25)26-16-9-6-10-17-26/h5-19,21,23,28H,4,20,22H2,1-3H3/b24-13+/t23-,28+/m1/s1 |
| InChIKey | SGGDKSPCQOOQMP-WXPCWQBBSA-N |
| XLogP | 5.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|