C27H27O3P — CID 102426265
[(3S,4R)-2,4-dimethyl-6-oxohex-1-en-3-yl] 2-diphenylphosphanylbenzoate (PubChem CID 102426265) has the molecular formula C27H27O3P and a molecular weight of 430.48 g/mol. Its IUPAC name is [(3S,4R)-2,4-dimethyl-6-oxohex-1-en-3-yl] 2-diphenylphosphanylbenzoate.
| Compound Name | [(3S,4R)-2,4-dimethyl-6-oxohex-1-en-3-yl] 2-diphenylphosphanylbenzoate |
|---|---|
| PubChem CID | 102426265 |
| Molecular Formula | C27H27O3P |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | [(3S,4R)-2,4-dimethyl-6-oxohex-1-en-3-yl] 2-diphenylphosphanylbenzoate |
| SMILES | C=C(C)[C@@H](OC(=O)c1ccccc1P(c1ccccc1)c1ccccc1)[C@H](C)CC=O |
| InChI | InChI=1S/C27H27O3P/c1-20(2)26(21(3)18-19-28)30-27(29)24-16-10-11-17-25(24)31(22-12-6-4-7-13-22)23-14-8-5-9-15-23/h4-17,19,21,26H,1,18H2,2-3H3/t21-,26-/m1/s1 |
| InChIKey | NJRUUZKCMRIUQU-QFQXNSOFSA-N |
| XLogP | 4.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|