C18H22F3NO5S — CID 10112901
2-[4-[2-[(E,3R)-3-hydroxy-3-[5-(trifluoromethyl)furan-2-yl]prop-1-enyl]-5-oxopyrrolidin-1-yl]butylsulfanyl]acetic acid (PubChem CID 10112901) has the molecular formula C18H22F3NO5S and a molecular weight of 421.44 g/mol. Its IUPAC name is 2-[4-[2-[(E,3R)-3-hydroxy-3-[5-(trifluoromethyl)furan-2-yl]prop-1-enyl]-5-oxopyrrolidin-1-yl]butylsulfanyl]acetic acid.
| Compound Name | 2-[4-[2-[(E,3R)-3-hydroxy-3-[5-(trifluoromethyl)furan-2-yl]prop-1-enyl]-5-oxopyrrolidin-1-yl]butylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 10112901 |
| Molecular Formula | C18H22F3NO5S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 2-[4-[2-[(E,3R)-3-hydroxy-3-[5-(trifluoromethyl)furan-2-yl]prop-1-enyl]-5-oxopyrrolidin-1-yl]butylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCCCN1C(=O)CCC1/C=C/[C@@H](O)c1ccc(C(F)(F)F)o1 |
| InChI | InChI=1S/C18H22F3NO5S/c19-18(20,21)15-7-6-14(27-15)13(23)5-3-12-4-8-16(24)22(12)9-1-2-10-28-11-17(25)26/h3,5-7,12-13,23H,1-2,4,8-11H2,(H,25,26)/b5-3+/t12?,13-/m1/s1 |
| InChIKey | FIBSROCPGKPOGF-OWTIGPFESA-N |
| XLogP | 3.48 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|