C22H21N3O4 — CID 101130263
(2S,13S)-5,6-dimethoxy-13-methyl-11,14,22-triazapentacyclo[12.8.0.02,11.03,8.016,21]docosa-1(22),3,5,7,16,18,20-heptaene-12,15-dione (PubChem CID 101130263) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is (2S,13S)-5,6-dimethoxy-13-methyl-11,14,22-triazapentacyclo[12.8.0.02,11.03,8.016,21]docosa-1(22),3,5,7,16,18,20-heptaene-12,15-dione.
| Compound Name | (2S,13S)-5,6-dimethoxy-13-methyl-11,14,22-triazapentacyclo[12.8.0.02,11.03,8.016,21]docosa-1(22),3,5,7,16,18,20-heptaene-12,15-dione |
|---|---|
| PubChem CID | 101130263 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (2S,13S)-5,6-dimethoxy-13-methyl-11,14,22-triazapentacyclo[12.8.0.02,11.03,8.016,21]docosa-1(22),3,5,7,16,18,20-heptaene-12,15-dione |
| SMILES | COc1cc2c(cc1OC)[C@H]1c3nc4ccccc4c(=O)n3[C@@H](C)C(=O)N1CC2 |
| InChI | InChI=1S/C22H21N3O4/c1-12-21(26)24-9-8-13-10-17(28-2)18(29-3)11-15(13)19(24)20-23-16-7-5-4-6-14(16)22(27)25(12)20/h4-7,10-12,19H,8-9H2,1-3H3/t12-,19-/m0/s1 |
| InChIKey | ZPANCODEGFIGBY-BUXKBTBVSA-N |
| XLogP | 2.46 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |