C24H28N2O3 — CID 101131756
(4S)-4-benzyl-5,5-dimethyl-3-[(5R)-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]-1,3-oxazolidin-2-one (PubChem CID 101131756) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is (4S)-4-benzyl-5,5-dimethyl-3-[(5R)-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-5,5-dimethyl-3-[(5R)-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101131756 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (4S)-4-benzyl-5,5-dimethyl-3-[(5R)-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]-1,3-oxazolidin-2-one |
| SMILES | Cc1cc(C)c(C2=NO[C@@H](N3C(=O)OC(C)(C)[C@@H]3Cc3ccccc3)C2)c(C)c1 |
| InChI | InChI=1S/C24H28N2O3/c1-15-11-16(2)22(17(3)12-15)19-14-21(29-25-19)26-20(24(4,5)28-23(26)27)13-18-9-7-6-8-10-18/h6-12,20-21H,13-14H2,1-5H3/t20-,21+/m0/s1 |
| InChIKey | IPOUJAKIBPYODU-LEWJYISDSA-N |
| XLogP | 4.90 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |