C23H29ClN4O2 — CID 10113433
N-butyl-2-[4-(4-chloro-3-methoxyphenyl)-5-pyridin-4-yl-2,3-dihydro-1H-imidazol-2-yl]-2-methylpropanamide (PubChem CID 10113433) has the molecular formula C23H29ClN4O2 and a molecular weight of 428.96 g/mol. Its IUPAC name is N-butyl-2-[4-(4-chloro-3-methoxyphenyl)-5-pyridin-4-yl-2,3-dihydro-1H-imidazol-2-yl]-2-methylpropanamide.
| Compound Name | N-butyl-2-[4-(4-chloro-3-methoxyphenyl)-5-pyridin-4-yl-2,3-dihydro-1H-imidazol-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 10113433 |
| Molecular Formula | C23H29ClN4O2 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | N-butyl-2-[4-(4-chloro-3-methoxyphenyl)-5-pyridin-4-yl-2,3-dihydro-1H-imidazol-2-yl]-2-methylpropanamide |
| SMILES | CCCCNC(=O)C(C)(C)C1NC(c2ccncc2)=C(c2ccc(Cl)c(OC)c2)N1 |
| InChI | InChI=1S/C23H29ClN4O2/c1-5-6-11-26-22(29)23(2,3)21-27-19(15-9-12-25-13-10-15)20(28-21)16-7-8-17(24)18(14-16)30-4/h7-10,12-14,21,27-28H,5-6,11H2,1-4H3,(H,26,29) |
| InChIKey | ASIMUUWXOLLAFP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|