C22H25ClN4O2 — CID 23614991
N-butyl-2-[4-(4-chloro-3-hydroxyphenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2-methylpropanamide (PubChem CID 23614991) has the molecular formula C22H25ClN4O2 and a molecular weight of 412.92 g/mol. Its IUPAC name is N-butyl-2-[4-(4-chloro-3-hydroxyphenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2-methylpropanamide.
| Compound Name | N-butyl-2-[4-(4-chloro-3-hydroxyphenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 23614991 |
| Molecular Formula | C22H25ClN4O2 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | N-butyl-2-[4-(4-chloro-3-hydroxyphenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2-methylpropanamide |
| SMILES | CCCCNC(=O)C(C)(C)c1nc(-c2ccc(Cl)c(O)c2)c(-c2ccncc2)[nH]1 |
| InChI | InChI=1S/C22H25ClN4O2/c1-4-5-10-25-21(29)22(2,3)20-26-18(14-8-11-24-12-9-14)19(27-20)15-6-7-16(23)17(28)13-15/h6-9,11-13,28H,4-5,10H2,1-3H3,(H,25,29)(H,26,27) |
| InChIKey | CRYPKLRJMKVZQE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|