C19H32O3 — CID 101135214
7-[(1S)-1-(1-ethoxyethoxy)ethyl]trideca-5,8-diyn-7-ol (PubChem CID 101135214) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is 7-[(1S)-1-(1-ethoxyethoxy)ethyl]trideca-5,8-diyn-7-ol.
| Compound Name | 7-[(1S)-1-(1-ethoxyethoxy)ethyl]trideca-5,8-diyn-7-ol |
|---|---|
| PubChem CID | 101135214 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 7-[(1S)-1-(1-ethoxyethoxy)ethyl]trideca-5,8-diyn-7-ol |
| SMILES | CCCCC#CC(O)(C#CCCCC)[C@H](C)OC(C)OCC |
| InChI | InChI=1S/C19H32O3/c1-6-9-11-13-15-19(20,16-14-12-10-7-2)17(4)22-18(5)21-8-3/h17-18,20H,6-12H2,1-5H3/t17-,18?/m0/s1 |
| InChIKey | SRXIACRUMKMJTM-ZENAZSQFSA-N |
| XLogP | 3.89 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|