C15H17F3O3S2 — CID 101135323
[4,4,4-trifluoro-2-(2-phenylethoxycarbothioylsulfanyl)butyl] acetate (PubChem CID 101135323) has the molecular formula C15H17F3O3S2 and a molecular weight of 366.43 g/mol. Its IUPAC name is [4,4,4-trifluoro-2-(2-phenylethoxycarbothioylsulfanyl)butyl] acetate.
| Compound Name | [4,4,4-trifluoro-2-(2-phenylethoxycarbothioylsulfanyl)butyl] acetate |
|---|---|
| PubChem CID | 101135323 |
| Molecular Formula | C15H17F3O3S2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | [4,4,4-trifluoro-2-(2-phenylethoxycarbothioylsulfanyl)butyl] acetate |
| SMILES | CC(=O)OCC(CC(F)(F)F)SC(=S)OCCc1ccccc1 |
| InChI | InChI=1S/C15H17F3O3S2/c1-11(19)21-10-13(9-15(16,17)18)23-14(22)20-8-7-12-5-3-2-4-6-12/h2-6,13H,7-10H2,1H3 |
| InChIKey | DVZCUNGTUZRFIQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|