C15H19F3O5S2 — CID 12717293
ethyl 2-[benzyl-prop-2-enyl-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]acetate (PubChem CID 12717293) has the molecular formula C15H19F3O5S2 and a molecular weight of 400.44 g/mol. Its IUPAC name is ethyl 2-[benzyl-prop-2-enyl-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]acetate.
| Compound Name | ethyl 2-[benzyl-prop-2-enyl-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]acetate |
|---|---|
| PubChem CID | 12717293 |
| Molecular Formula | C15H19F3O5S2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | ethyl 2-[benzyl-prop-2-enyl-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]acetate |
| SMILES | C=CCS(CC(=O)OCC)(Cc1ccccc1)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C15H19F3O5S2/c1-3-10-24(12-14(19)22-4-2,11-13-8-6-5-7-9-13)23-25(20,21)15(16,17)18/h3,5-9H,1,4,10-12H2,2H3 |
| InChIKey | AAUWVHWHPPYBTG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|