C16H30O2Si — CID 101137268
tert-butyl-[(E)-4-[(2S,3S)-3-ethenyl-3-methyloxiran-2-yl]-2-methylbut-3-en-2-yl]oxy-dimethylsilane (PubChem CID 101137268) has the molecular formula C16H30O2Si and a molecular weight of 282.50 g/mol. Its IUPAC name is tert-butyl-[(E)-4-[(2S,3S)-3-ethenyl-3-methyloxiran-2-yl]-2-methylbut-3-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E)-4-[(2S,3S)-3-ethenyl-3-methyloxiran-2-yl]-2-methylbut-3-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 101137268 |
| Molecular Formula | C16H30O2Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | tert-butyl-[(E)-4-[(2S,3S)-3-ethenyl-3-methyloxiran-2-yl]-2-methylbut-3-en-2-yl]oxy-dimethylsilane |
| SMILES | C=C[C@]1(C)O[C@H]1/C=C/C(C)(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30O2Si/c1-10-16(7)13(17-16)11-12-15(5,6)18-19(8,9)14(2,3)4/h10-13H,1H2,2-9H3/b12-11+/t13-,16-/m0/s1 |
| InChIKey | OVDOHSLKLNKCSH-XPMIASGBSA-N |
| XLogP | 4.69 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|