C17H34O2Si — CID 134960946
tert-butyl-dimethyl-[(3S,4S)-3-methyl-4-(3-methylbut-2-enoxy)pent-1-en-3-yl]oxysilane (PubChem CID 134960946) has the molecular formula C17H34O2Si and a molecular weight of 298.54 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3S,4S)-3-methyl-4-(3-methylbut-2-enoxy)pent-1-en-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3S,4S)-3-methyl-4-(3-methylbut-2-enoxy)pent-1-en-3-yl]oxysilane |
|---|---|
| PubChem CID | 134960946 |
| Molecular Formula | C17H34O2Si |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | tert-butyl-dimethyl-[(3S,4S)-3-methyl-4-(3-methylbut-2-enoxy)pent-1-en-3-yl]oxysilane |
| SMILES | C=C[C@](C)(O[Si](C)(C)C(C)(C)C)[C@H](C)OCC=C(C)C |
| InChI | InChI=1S/C17H34O2Si/c1-11-17(8,15(4)18-13-12-14(2)3)19-20(9,10)16(5,6)7/h11-12,15H,1,13H2,2-10H3/t15-,17-/m0/s1 |
| InChIKey | RKNADTFXGHHRPJ-RDJZCZTQSA-N |
| XLogP | 5.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|