C16H30O2Si — CID 10708071
tert-butyl-dimethyl-[3-[(1S)-1-prop-2-enoxyethyl]penta-1,4-dien-3-yloxy]silane (PubChem CID 10708071) has the molecular formula C16H30O2Si and a molecular weight of 282.50 g/mol. Its IUPAC name is tert-butyl-dimethyl-[3-[(1S)-1-prop-2-enoxyethyl]penta-1,4-dien-3-yloxy]silane.
| Compound Name | tert-butyl-dimethyl-[3-[(1S)-1-prop-2-enoxyethyl]penta-1,4-dien-3-yloxy]silane |
|---|---|
| PubChem CID | 10708071 |
| Molecular Formula | C16H30O2Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | tert-butyl-dimethyl-[3-[(1S)-1-prop-2-enoxyethyl]penta-1,4-dien-3-yloxy]silane |
| SMILES | C=CCO[C@@H](C)C(C=C)(C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30O2Si/c1-10-13-17-14(4)16(11-2,12-3)18-19(8,9)15(5,6)7/h10-12,14H,1-3,13H2,4-9H3/t14-/m0/s1 |
| InChIKey | RNVARBBHIHXWGU-AWEZNQCLSA-N |
| XLogP | 4.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|