C18H40O2Si4 — CID 134854197
trimethyl-[[(3R,4R)-4-prop-2-enoxyhexa-1,5-dien-3-yl]oxy-bis(trimethylsilyl)silyl]silane (PubChem CID 134854197) has the molecular formula C18H40O2Si4 and a molecular weight of 400.86 g/mol. Its IUPAC name is trimethyl-[[(3R,4R)-4-prop-2-enoxyhexa-1,5-dien-3-yl]oxy-bis(trimethylsilyl)silyl]silane.
| Compound Name | trimethyl-[[(3R,4R)-4-prop-2-enoxyhexa-1,5-dien-3-yl]oxy-bis(trimethylsilyl)silyl]silane |
|---|---|
| PubChem CID | 134854197 |
| Molecular Formula | C18H40O2Si4 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | trimethyl-[[(3R,4R)-4-prop-2-enoxyhexa-1,5-dien-3-yl]oxy-bis(trimethylsilyl)silyl]silane |
| SMILES | C=CCO[C@H](C=C)[C@@H](C=C)O[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C18H40O2Si4/c1-13-16-19-17(14-2)18(15-3)20-24(21(4,5)6,22(7,8)9)23(10,11)12/h13-15,17-18H,1-3,16H2,4-12H3/t17-,18-/m1/s1 |
| InChIKey | AWXRLFSTYRQXLO-QZTJIDSGSA-N |
| XLogP | 5.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|