C16H36O2Si4 — CID 122215280
(2-ethenyl-3,6-dihydro-2H-pyran-3-yl)oxy-tris(trimethylsilyl)silane (PubChem CID 122215280) has the molecular formula C16H36O2Si4 and a molecular weight of 372.81 g/mol. Its IUPAC name is (2-ethenyl-3,6-dihydro-2H-pyran-3-yl)oxy-tris(trimethylsilyl)silane.
| Compound Name | (2-ethenyl-3,6-dihydro-2H-pyran-3-yl)oxy-tris(trimethylsilyl)silane |
|---|---|
| PubChem CID | 122215280 |
| Molecular Formula | C16H36O2Si4 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (2-ethenyl-3,6-dihydro-2H-pyran-3-yl)oxy-tris(trimethylsilyl)silane |
| SMILES | C=CC1OCC=CC1O[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C16H36O2Si4/c1-11-15-16(13-12-14-17-15)18-22(19(2,3)4,20(5,6)7)21(8,9)10/h11-13,15-16H,1,14H2,2-10H3 |
| InChIKey | CTRQYGKKTQTQRH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|