C11H22O2Si — CID 72750800
tert-butyl-[(3-ethenyloxiran-2-yl)methoxy]-dimethylsilane (PubChem CID 72750800) has the molecular formula C11H22O2Si and a molecular weight of 214.38 g/mol. Its IUPAC name is tert-butyl-[(3-ethenyloxiran-2-yl)methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3-ethenyloxiran-2-yl)methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 72750800 |
| Molecular Formula | C11H22O2Si |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | tert-butyl-[(3-ethenyloxiran-2-yl)methoxy]-dimethylsilane |
| SMILES | C=CC1OC1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H22O2Si/c1-7-9-10(13-9)8-12-14(5,6)11(2,3)4/h7,9-10H,1,8H2,2-6H3 |
| InChIKey | GPWVGLABDIOHCY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|