C8H16OSi — CID 11513786
trimethyl-[(E)-2-[(2R,3S)-3-methyloxiran-2-yl]ethenyl]silane (PubChem CID 11513786) has the molecular formula C8H16OSi and a molecular weight of 156.30 g/mol. Its IUPAC name is trimethyl-[(E)-2-[(2R,3S)-3-methyloxiran-2-yl]ethenyl]silane.
| Compound Name | trimethyl-[(E)-2-[(2R,3S)-3-methyloxiran-2-yl]ethenyl]silane |
|---|---|
| PubChem CID | 11513786 |
| Molecular Formula | C8H16OSi |
| Molecular Weight | 156.30 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | trimethyl-[(E)-2-[(2R,3S)-3-methyloxiran-2-yl]ethenyl]silane |
| SMILES | C[C@@H]1O[C@@H]1/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C8H16OSi/c1-7-8(9-7)5-6-10(2,3)4/h5-8H,1-4H3/b6-5+/t7-,8+/m0/s1 |
| InChIKey | HCRGEZCLAYPAOE-LXBADBFVSA-N |
| XLogP | 2.21 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|