C10H22OSi2 — CID 11447224
trimethyl-[(2S,3S)-3-[(E)-2-trimethylsilylethenyl]oxiran-2-yl]silane (PubChem CID 11447224) has the molecular formula C10H22OSi2 and a molecular weight of 214.46 g/mol. Its IUPAC name is trimethyl-[(2S,3S)-3-[(E)-2-trimethylsilylethenyl]oxiran-2-yl]silane.
| Compound Name | trimethyl-[(2S,3S)-3-[(E)-2-trimethylsilylethenyl]oxiran-2-yl]silane |
|---|---|
| PubChem CID | 11447224 |
| Molecular Formula | C10H22OSi2 |
| Molecular Weight | 214.46 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | trimethyl-[(2S,3S)-3-[(E)-2-trimethylsilylethenyl]oxiran-2-yl]silane |
| SMILES | C[Si](C)(C)/C=C/[C@@H]1O[C@H]1[Si](C)(C)C |
| InChI | InChI=1S/C10H22OSi2/c1-12(2,3)8-7-9-10(11-9)13(4,5)6/h7-10H,1-6H3/b8-7+/t9-,10-/m0/s1 |
| InChIKey | KZFLJWWRHHASAO-GOPXOUGQSA-N |
| XLogP | 3.06 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|