C12H24OSi2 — CID 134995810
trimethyl-[(E)-2-[(2R,3R)-3-[(E)-2-trimethylsilylethenyl]oxiran-2-yl]ethenyl]silane (PubChem CID 134995810) has the molecular formula C12H24OSi2 and a molecular weight of 240.49 g/mol. Its IUPAC name is trimethyl-[(E)-2-[(2R,3R)-3-[(E)-2-trimethylsilylethenyl]oxiran-2-yl]ethenyl]silane.
| Compound Name | trimethyl-[(E)-2-[(2R,3R)-3-[(E)-2-trimethylsilylethenyl]oxiran-2-yl]ethenyl]silane |
|---|---|
| PubChem CID | 134995810 |
| Molecular Formula | C12H24OSi2 |
| Molecular Weight | 240.49 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | trimethyl-[(E)-2-[(2R,3R)-3-[(E)-2-trimethylsilylethenyl]oxiran-2-yl]ethenyl]silane |
| SMILES | C[Si](C)(C)/C=C/[C@H]1O[C@@H]1/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C12H24OSi2/c1-14(2,3)9-7-11-12(13-11)8-10-15(4,5)6/h7-12H,1-6H3/b9-7+,10-8+/t11-,12-/m1/s1 |
| InChIKey | BFAWIEHHJMOLCI-NVXYJICISA-N |
| XLogP | 3.62 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|