C13H28OSi2 — CID 101267810
tert-butyl-[(2S,3R)-3-ethenyl-2-trimethylsilyloxiran-2-yl]-dimethylsilane (PubChem CID 101267810) has the molecular formula C13H28OSi2 and a molecular weight of 256.54 g/mol. Its IUPAC name is tert-butyl-[(2S,3R)-3-ethenyl-2-trimethylsilyloxiran-2-yl]-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3R)-3-ethenyl-2-trimethylsilyloxiran-2-yl]-dimethylsilane |
|---|---|
| PubChem CID | 101267810 |
| Molecular Formula | C13H28OSi2 |
| Molecular Weight | 256.54 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | tert-butyl-[(2S,3R)-3-ethenyl-2-trimethylsilyloxiran-2-yl]-dimethylsilane |
| SMILES | C=C[C@H]1O[C@@]1([Si](C)(C)C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H28OSi2/c1-10-11-13(14-11,15(5,6)7)16(8,9)12(2,3)4/h10-11H,1H2,2-9H3/t11-,13+/m1/s1 |
| InChIKey | ZUUUEBWQDRBDMQ-YPMHNXCESA-N |
| XLogP | 4.24 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|