C11H22OSi — CID 72974056
tert-butyl-(3-ethenyl-2-methyloxiran-2-yl)-dimethylsilane (PubChem CID 72974056) has the molecular formula C11H22OSi and a molecular weight of 198.38 g/mol. Its IUPAC name is tert-butyl-(3-ethenyl-2-methyloxiran-2-yl)-dimethylsilane.
| Compound Name | tert-butyl-(3-ethenyl-2-methyloxiran-2-yl)-dimethylsilane |
|---|---|
| PubChem CID | 72974056 |
| Molecular Formula | C11H22OSi |
| Molecular Weight | 198.38 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | tert-butyl-(3-ethenyl-2-methyloxiran-2-yl)-dimethylsilane |
| SMILES | C=CC1OC1(C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H22OSi/c1-8-9-11(5,12-9)13(6,7)10(2,3)4/h8-9H,1H2,2-7H3 |
| InChIKey | ZOTWBFUPGNIQRO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|