C8H16O2Si — CID 134863495
trimethyl-[(1R)-1-[(2S)-oxiran-2-yl]prop-2-enoxy]silane (PubChem CID 134863495) has the molecular formula C8H16O2Si and a molecular weight of 172.30 g/mol. Its IUPAC name is trimethyl-[(1R)-1-[(2S)-oxiran-2-yl]prop-2-enoxy]silane.
| Compound Name | trimethyl-[(1R)-1-[(2S)-oxiran-2-yl]prop-2-enoxy]silane |
|---|---|
| PubChem CID | 134863495 |
| Molecular Formula | C8H16O2Si |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | trimethyl-[(1R)-1-[(2S)-oxiran-2-yl]prop-2-enoxy]silane |
| SMILES | C=C[C@@H](O[Si](C)(C)C)[C@@H]1CO1 |
| InChI | InChI=1S/C8H16O2Si/c1-5-7(8-6-9-8)10-11(2,3)4/h5,7-8H,1,6H2,2-4H3/t7-,8+/m1/s1 |
| InChIKey | AKHRFRKYWINYIG-SFYZADRCSA-N |
| XLogP | 1.79 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|