C12H24O2Si — CID 11160538
tert-butyl-[[(2S,3S)-3-ethenyl-2-methyloxiran-2-yl]methoxy]-dimethylsilane (PubChem CID 11160538) has the molecular formula C12H24O2Si and a molecular weight of 228.41 g/mol. Its IUPAC name is tert-butyl-[[(2S,3S)-3-ethenyl-2-methyloxiran-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S,3S)-3-ethenyl-2-methyloxiran-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11160538 |
| Molecular Formula | C12H24O2Si |
| Molecular Weight | 228.41 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | tert-butyl-[[(2S,3S)-3-ethenyl-2-methyloxiran-2-yl]methoxy]-dimethylsilane |
| SMILES | C=C[C@@H]1O[C@@]1(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H24O2Si/c1-8-10-12(5,14-10)9-13-15(6,7)11(2,3)4/h8,10H,1,9H2,2-7H3/t10-,12-/m0/s1 |
| InChIKey | OOZPXSKBSSBRRR-JQWIXIFHSA-N |
| XLogP | 3.35 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|