C20H26N2 — CID 101140179
(1R,9R,16R,18S,21S)-18-methyl-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene (PubChem CID 101140179) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is (1R,9R,16R,18S,21S)-18-methyl-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene.
| Compound Name | (1R,9R,16R,18S,21S)-18-methyl-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene |
|---|---|
| PubChem CID | 101140179 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | (1R,9R,16R,18S,21S)-18-methyl-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene |
| SMILES | C[C@H]1C[C@@]23CCCN4CC[C@@]5(c6ccccc6N[C@]15CC2)[C@@H]43 |
| InChI | InChI=1S/C20H26N2/c1-14-13-18-7-4-11-22-12-10-19(17(18)22)15-5-2-3-6-16(15)21-20(14,19)9-8-18/h2-3,5-6,14,17,21H,4,7-13H2,1H3/t14-,17-,18+,19+,20+/m0/s1 |
| InChIKey | LWDSCKZIMLANTE-IGGMLHCZSA-N |
| XLogP | 3.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |