C20H26N2O2 — CID 101287781
(1S,9R,16R,21S)-4-methoxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-trien-18-ol (PubChem CID 101287781) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is (1S,9R,16R,21S)-4-methoxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-trien-18-ol.
| Compound Name | (1S,9R,16R,21S)-4-methoxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-trien-18-ol |
|---|---|
| PubChem CID | 101287781 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | (1S,9R,16R,21S)-4-methoxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-trien-18-ol |
| SMILES | COc1cccc2c1N[C@@]13CC[C@]4(CCCN5CC[C@]21[C@@H]54)CC3O |
| InChI | InChI=1S/C20H26N2O2/c1-24-14-5-2-4-13-16(14)21-20-8-7-18(12-15(20)23)6-3-10-22-11-9-19(13,20)17(18)22/h2,4-5,15,17,21,23H,3,6-12H2,1H3/t15?,17-,18+,19+,20+/m0/s1 |
| InChIKey | BOBSOTRVHIVYGH-TYWFAVLNSA-N |
| XLogP | 2.51 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |