C21H24N2O3 — CID 122204052
(1R,4R,12R,13S,16R,18S)-18-hydroxy-7-methoxy-5,14-diazaheptacyclo[12.5.3.01,13.04,12.04,18.06,11.012,16]docosa-6(11),7,9-trien-17-one (PubChem CID 122204052) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is (1R,4R,12R,13S,16R,18S)-18-hydroxy-7-methoxy-5,14-diazaheptacyclo[12.5.3.01,13.04,12.04,18.06,11.012,16]docosa-6(11),7,9-trien-17-one.
| Compound Name | (1R,4R,12R,13S,16R,18S)-18-hydroxy-7-methoxy-5,14-diazaheptacyclo[12.5.3.01,13.04,12.04,18.06,11.012,16]docosa-6(11),7,9-trien-17-one |
|---|---|
| PubChem CID | 122204052 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (1R,4R,12R,13S,16R,18S)-18-hydroxy-7-methoxy-5,14-diazaheptacyclo[12.5.3.01,13.04,12.04,18.06,11.012,16]docosa-6(11),7,9-trien-17-one |
| SMILES | COc1cccc2c1N[C@@]13CC[C@]45CCCN6C[C@H](C(=O)[C@]1(O)C4)[C@]23[C@@H]65 |
| InChI | InChI=1S/C21H24N2O3/c1-26-14-5-2-4-12-15(14)22-20-8-7-18-6-3-9-23-10-13(21(12,20)17(18)23)16(24)19(20,25)11-18/h2,4-5,13,17,22,25H,3,6-11H2,1H3/t13-,17+,18-,19-,20+,21+/m1/s1 |
| InChIKey | LPNXPYMZDWUSJO-WOINSVNBSA-N |
| XLogP | 1.69 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |