C22H28N2O4 — CID 162937691
methyl (1S,9R,16R,18S,21S)-18-hydroxy-4-methoxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-triene-18-carboxylate (PubChem CID 162937691) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is methyl (1S,9R,16R,18S,21S)-18-hydroxy-4-methoxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-triene-18-carboxylate.
| Compound Name | methyl (1S,9R,16R,18S,21S)-18-hydroxy-4-methoxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-triene-18-carboxylate |
|---|---|
| PubChem CID | 162937691 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | methyl (1S,9R,16R,18S,21S)-18-hydroxy-4-methoxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-triene-18-carboxylate |
| SMILES | COC(=O)[C@]1(O)C[C@@]23CCCN4CC[C@@]5(c6cccc(OC)c6N[C@]15CC2)[C@@H]43 |
| InChI | InChI=1S/C22H28N2O4/c1-27-15-6-3-5-14-16(15)23-22-9-8-19(13-21(22,26)18(25)28-2)7-4-11-24-12-10-20(14,22)17(19)24/h3,5-6,17,23,26H,4,7-13H2,1-2H3/t17-,19+,20+,21+,22-/m0/s1 |
| InChIKey | ADIZHYKMXNXYPA-NBYDKTAJSA-N |
| XLogP | 2.05 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |