C23H30N2O2 — CID 162820734
1-[(22S)-4-methoxy-2,12-diazahexacyclo[14.3.2.19,12.01,9.03,8.016,22]docosa-3(8),4,6-trien-2-yl]ethanone (PubChem CID 162820734) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 1-[(22S)-4-methoxy-2,12-diazahexacyclo[14.3.2.19,12.01,9.03,8.016,22]docosa-3(8),4,6-trien-2-yl]ethanone.
| Compound Name | 1-[(22S)-4-methoxy-2,12-diazahexacyclo[14.3.2.19,12.01,9.03,8.016,22]docosa-3(8),4,6-trien-2-yl]ethanone |
|---|---|
| PubChem CID | 162820734 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 1-[(22S)-4-methoxy-2,12-diazahexacyclo[14.3.2.19,12.01,9.03,8.016,22]docosa-3(8),4,6-trien-2-yl]ethanone |
| SMILES | COc1cccc2c1N(C(C)=O)C13CCCC4(CCCN5CCC21[C@@H]54)CC3 |
| InChI | InChI=1S/C23H30N2O2/c1-16(26)25-19-17(6-3-7-18(19)27-2)23-13-15-24-14-5-9-21(20(23)24)8-4-10-22(23,25)12-11-21/h3,6-7,20H,4-5,8-15H2,1-2H3/t20-,21?,22?,23?/m0/s1 |
| InChIKey | QUJGDBXRYRHXEW-LEISRSHCSA-N |
| XLogP | 3.87 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |