C22H28N2O5 — CID 22296074
methyl 2-[(1R,9R,12S,19S)-8-formyl-6-methoxy-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5-trien-12-yl]-2-hydroxyacetate (PubChem CID 22296074) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is methyl 2-[(1R,9R,12S,19S)-8-formyl-6-methoxy-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5-trien-12-yl]-2-hydroxyacetate.
| Compound Name | methyl 2-[(1R,9R,12S,19S)-8-formyl-6-methoxy-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5-trien-12-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 22296074 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | methyl 2-[(1R,9R,12S,19S)-8-formyl-6-methoxy-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5-trien-12-yl]-2-hydroxyacetate |
| SMILES | COC(=O)C(O)[C@@]12CCCN3CC[C@]4(c5cccc(OC)c5N(C=O)[C@@H]4CC1)[C@H]32 |
| InChI | InChI=1S/C22H28N2O5/c1-28-15-6-3-5-14-17(15)24(13-25)16-7-9-21(18(26)19(27)29-2)8-4-11-23-12-10-22(14,16)20(21)23/h3,5-6,13,16,18,20,26H,4,7-12H2,1-2H3/t16-,18?,20-,21-,22-/m1/s1 |
| InChIKey | DPVMNNORLOZDRE-XACAIICQSA-N |
| XLogP | 1.46 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|