C25H32N2O9 — CID 24795516
trimethyl (1R,9S,10R,13S,14S,20R)-9,14-dihydroxy-6-methoxy-8,17-diazapentacyclo[11.6.1.01,10.02,7.017,20]icosa-2(7),3,5-triene-8,9,13-tricarboxylate (PubChem CID 24795516) has the molecular formula C25H32N2O9 and a molecular weight of 504.54 g/mol. Its IUPAC name is trimethyl (1R,9S,10R,13S,14S,20R)-9,14-dihydroxy-6-methoxy-8,17-diazapentacyclo[11.6.1.01,10.02,7.017,20]icosa-2(7),3,5-triene-8,9,13-tricarboxylate.
| Compound Name | trimethyl (1R,9S,10R,13S,14S,20R)-9,14-dihydroxy-6-methoxy-8,17-diazapentacyclo[11.6.1.01,10.02,7.017,20]icosa-2(7),3,5-triene-8,9,13-tricarboxylate |
|---|---|
| PubChem CID | 24795516 |
| Molecular Formula | C25H32N2O9 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | trimethyl (1R,9S,10R,13S,14S,20R)-9,14-dihydroxy-6-methoxy-8,17-diazapentacyclo[11.6.1.01,10.02,7.017,20]icosa-2(7),3,5-triene-8,9,13-tricarboxylate |
| SMILES | COC(=O)N1c2c(OC)cccc2[C@@]23CCN4CC[C@H](O)[C@](C(=O)OC)(CC[C@H]2[C@]1(O)C(=O)OC)[C@H]43 |
| InChI | InChI=1S/C25H32N2O9/c1-33-15-7-5-6-14-18(15)27(22(31)36-4)25(32,21(30)35-3)16-8-10-24(20(29)34-2)17(28)9-12-26-13-11-23(14,16)19(24)26/h5-7,16-17,19,28,32H,8-13H2,1-4H3/t16-,17+,19-,23+,24-,25+/m1/s1 |
| InChIKey | QLKIEYHPCSAOJT-XEQMFJGLSA-N |
| XLogP | 0.79 |
| TPSA | 135.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|