C22H32N2O2 — CID 22216838
2-[(1R,9R,12R,19R)-8-ethyl-6-methoxy-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5-trien-12-yl]ethanol (PubChem CID 22216838) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 2-[(1R,9R,12R,19R)-8-ethyl-6-methoxy-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5-trien-12-yl]ethanol.
| Compound Name | 2-[(1R,9R,12R,19R)-8-ethyl-6-methoxy-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5-trien-12-yl]ethanol |
|---|---|
| PubChem CID | 22216838 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 2-[(1R,9R,12R,19R)-8-ethyl-6-methoxy-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5-trien-12-yl]ethanol |
| SMILES | CCN1c2c(OC)cccc2[C@]23CCN4CCC[C@](CCO)(CC[C@@H]12)[C@@H]43 |
| InChI | InChI=1S/C22H32N2O2/c1-3-24-18-8-10-21(12-15-25)9-5-13-23-14-11-22(18,20(21)23)16-6-4-7-17(26-2)19(16)24/h4,6-7,18,20,25H,3,5,8-15H2,1-2H3/t18-,20-,21-,22-/m1/s1 |
| InChIKey | IKGVIMSYVWDDBP-ZHHKINOHSA-N |
| XLogP | 3.17 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |