C38H52N4 — CID 139050168
(1R,9R,12R,19R)-12-ethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-triene (PubChem CID 139050168) has the molecular formula C38H52N4 and a molecular weight of 564.86 g/mol. Its IUPAC name is (1R,9R,12R,19R)-12-ethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-triene.
| Compound Name | (1R,9R,12R,19R)-12-ethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-triene |
|---|---|
| PubChem CID | 139050168 |
| Molecular Formula | C38H52N4 |
| Molecular Weight | 564.86 g/mol |
| Exact Mass | 564.42 |
| IUPAC Name | (1R,9R,12R,19R)-12-ethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-triene |
| SMILES | CC[C@@]12CCCN3CC[C@]4(c5ccccc5N[C@@H]4CC1)[C@H]32.CC[C@@]12CCCN3CC[C@]4(c5ccccc5N[C@@H]4CC1)[C@H]32 |
| InChI | InChI=1S/2C19H26N2/c2*1-2-18-9-5-12-21-13-11-19(17(18)21)14-6-3-4-7-15(14)20-16(19)8-10-18/h2*3-4,6-7,16-17,20H,2,5,8-13H2,1H3/t2*16-,17-,18-,19-/m11/s1 |
| InChIKey | BOIPKNIZAOKNTG-CVEICUFJSA-N |
| XLogP | 7.55 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.86 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |