C21H28N2O3 — CID 173447867
methyl (1R,9R,12R,19S)-12-ethyl-13-hydroxy-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-triene-13-carboxylate (PubChem CID 173447867) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is methyl (1R,9R,12R,19S)-12-ethyl-13-hydroxy-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-triene-13-carboxylate.
| Compound Name | methyl (1R,9R,12R,19S)-12-ethyl-13-hydroxy-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-triene-13-carboxylate |
|---|---|
| PubChem CID | 173447867 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | methyl (1R,9R,12R,19S)-12-ethyl-13-hydroxy-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-triene-13-carboxylate |
| SMILES | CC[C@]12CC[C@H]3Nc4ccccc4[C@]34CCN(CCC1(O)C(=O)OC)[C@@H]42 |
| InChI | InChI=1S/C21H28N2O3/c1-3-19-9-8-16-20(14-6-4-5-7-15(14)22-16)10-12-23(17(19)20)13-11-21(19,25)18(24)26-2/h4-7,16-17,22,25H,3,8-13H2,1-2H3/t16-,17-,19-,20-,21?/m1/s1 |
| InChIKey | QNYLTJKVEKEAHD-FBPXKZGXSA-N |
| XLogP | 2.29 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |