C25H32N2O5 — CID 101287836
methyl (1R,9R,15R,16S,18R,21R)-2-acetyl-4,15-dimethoxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-triene-18-carboxylate (PubChem CID 101287836) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is methyl (1R,9R,15R,16S,18R,21R)-2-acetyl-4,15-dimethoxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-triene-18-carboxylate.
| Compound Name | methyl (1R,9R,15R,16S,18R,21R)-2-acetyl-4,15-dimethoxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-triene-18-carboxylate |
|---|---|
| PubChem CID | 101287836 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | methyl (1R,9R,15R,16S,18R,21R)-2-acetyl-4,15-dimethoxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-triene-18-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@]23CC[C@@]14N(C(C)=O)c1c(OC)cccc1[C@@]41CCN(CC[C@H]2OC)[C@@H]31 |
| InChI | InChI=1S/C25H32N2O5/c1-15(28)27-20-16(6-5-7-18(20)30-2)24-11-13-26-12-8-19(31-3)23(22(24)26)9-10-25(24,27)17(14-23)21(29)32-4/h5-7,17,19,22H,8-14H2,1-4H3/t17-,19+,22-,23+,24+,25+/m0/s1 |
| InChIKey | GNRCMQYGBOTWCN-PMSRPSIBSA-N |
| XLogP | 2.50 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |