C23H30N2O3 — CID 101287774
methyl (1R,9R,15R,16S,18R,21R)-15-methoxy-2-methyl-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-18-carboxylate (PubChem CID 101287774) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is methyl (1R,9R,15R,16S,18R,21R)-15-methoxy-2-methyl-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-18-carboxylate.
| Compound Name | methyl (1R,9R,15R,16S,18R,21R)-15-methoxy-2-methyl-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-18-carboxylate |
|---|---|
| PubChem CID | 101287774 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | methyl (1R,9R,15R,16S,18R,21R)-15-methoxy-2-methyl-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-18-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@]23CC[C@@]14N(C)c1ccccc1[C@@]41CCN(CC[C@H]2OC)[C@@H]31 |
| InChI | InChI=1S/C23H30N2O3/c1-24-17-7-5-4-6-15(17)22-11-13-25-12-8-18(27-2)21(20(22)25)9-10-23(22,24)16(14-21)19(26)28-3/h4-7,16,18,20H,8-14H2,1-3H3/t16-,18+,20-,21+,22+,23+/m0/s1 |
| InChIKey | HAQUEWPLDWGUEX-OHLBYZNXSA-N |
| XLogP | 2.58 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |