C25H30N2O5 — CID 540038
methyl 2-acetyl-15-acetyloxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-18-carboxylate (PubChem CID 540038) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is methyl 2-acetyl-15-acetyloxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-18-carboxylate.
| Compound Name | methyl 2-acetyl-15-acetyloxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-18-carboxylate |
|---|---|
| PubChem CID | 540038 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | methyl 2-acetyl-15-acetyloxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-18-carboxylate |
| SMILES | COC(=O)C1CC23CCC14N(C(C)=O)c1ccccc1C41CCN(CCC2OC(C)=O)C31 |
| InChI | InChI=1S/C25H30N2O5/c1-15(28)27-19-7-5-4-6-17(19)24-11-13-26-12-8-20(32-16(2)29)23(22(24)26)9-10-25(24,27)18(14-23)21(30)31-3/h4-7,18,20,22H,8-14H2,1-3H3 |
| InChIKey | NBLUGSRVKSXCHB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |