C25H32N2O7 — CID 72758498
dimethyl 18-hydroxy-4,5-dimethoxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-triene-2,18-dicarboxylate (PubChem CID 72758498) has the molecular formula C25H32N2O7 and a molecular weight of 472.54 g/mol. Its IUPAC name is dimethyl 18-hydroxy-4,5-dimethoxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-triene-2,18-dicarboxylate.
| Compound Name | dimethyl 18-hydroxy-4,5-dimethoxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-triene-2,18-dicarboxylate |
|---|---|
| PubChem CID | 72758498 |
| Molecular Formula | C25H32N2O7 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | dimethyl 18-hydroxy-4,5-dimethoxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-triene-2,18-dicarboxylate |
| SMILES | COC(=O)N1c2c(ccc(OC)c2OC)C23CCN4CCCC5(CCC12C(O)(C(=O)OC)C5)C43 |
| InChI | InChI=1S/C25H32N2O7/c1-31-16-7-6-15-17(18(16)32-2)27(21(29)34-4)25-10-9-22(14-24(25,30)20(28)33-3)8-5-12-26-13-11-23(15,25)19(22)26/h6-7,19,30H,5,8-14H2,1-4H3 |
| InChIKey | OUKMTJXIZGCDBO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |