C25H32N2O8 — CID 101089606
dimethyl (1S,9S,16R,18S,21R)-18,21-dihydroxy-4,5-dimethoxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-triene-2,18-dicarboxylate (PubChem CID 101089606) has the molecular formula C25H32N2O8 and a molecular weight of 488.54 g/mol. Its IUPAC name is dimethyl (1S,9S,16R,18S,21R)-18,21-dihydroxy-4,5-dimethoxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-triene-2,18-dicarboxylate.
| Compound Name | dimethyl (1S,9S,16R,18S,21R)-18,21-dihydroxy-4,5-dimethoxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-triene-2,18-dicarboxylate |
|---|---|
| PubChem CID | 101089606 |
| Molecular Formula | C25H32N2O8 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | dimethyl (1S,9S,16R,18S,21R)-18,21-dihydroxy-4,5-dimethoxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-triene-2,18-dicarboxylate |
| SMILES | COC(=O)N1c2c(ccc(OC)c2OC)[C@@]23CCN4CCC[C@]5(CC[C@]12[C@](O)(C(=O)OC)C5)[C@]43O |
| InChI | InChI=1S/C25H32N2O8/c1-32-16-7-6-15-17(18(16)33-2)27(20(29)35-4)24-10-9-21(14-23(24,30)19(28)34-3)8-5-12-26-13-11-22(15,24)25(21,26)31/h6-7,30-31H,5,8-14H2,1-4H3/t21-,22+,23-,24+,25-/m1/s1 |
| InChIKey | YXJPQNVEMKOYJM-MBWGTIHESA-N |
| XLogP | 1.54 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |