C25H28N2O9 — CID 162934116
trimethyl (1R,9R,10R)-9-hydroxy-6-methoxy-15-(3-oxoprop-1-enyl)-8,15-diazatetracyclo[8.7.0.01,14.02,7]heptadeca-2(7),3,5,13-tetraene-8,9,13-tricarboxylate (PubChem CID 162934116) has the molecular formula C25H28N2O9 and a molecular weight of 500.50 g/mol. Its IUPAC name is trimethyl (1R,9R,10R)-9-hydroxy-6-methoxy-15-(3-oxoprop-1-enyl)-8,15-diazatetracyclo[8.7.0.01,14.02,7]heptadeca-2(7),3,5,13-tetraene-8,9,13-tricarboxylate.
| Compound Name | trimethyl (1R,9R,10R)-9-hydroxy-6-methoxy-15-(3-oxoprop-1-enyl)-8,15-diazatetracyclo[8.7.0.01,14.02,7]heptadeca-2(7),3,5,13-tetraene-8,9,13-tricarboxylate |
|---|---|
| PubChem CID | 162934116 |
| Molecular Formula | C25H28N2O9 |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | trimethyl (1R,9R,10R)-9-hydroxy-6-methoxy-15-(3-oxoprop-1-enyl)-8,15-diazatetracyclo[8.7.0.01,14.02,7]heptadeca-2(7),3,5,13-tetraene-8,9,13-tricarboxylate |
| SMILES | COC(=O)C1=C2N(C=CC=O)CC[C@@]23c2cccc(OC)c2N(C(=O)OC)[C@](O)(C(=O)OC)[C@@H]3CC1 |
| InChI | InChI=1S/C25H28N2O9/c1-33-17-8-5-7-16-19(17)27(23(31)36-4)25(32,22(30)35-3)18-10-9-15(21(29)34-2)20-24(16,18)11-13-26(20)12-6-14-28/h5-8,12,14,18,32H,9-11,13H2,1-4H3/t18-,24+,25-/m1/s1 |
| InChIKey | HBGXWHCXKYSLJC-AYCKEJKLSA-N |
| XLogP | 1.64 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|