C21H26N2O3 — CID 132576285
(1R,4S,12R,13S,16R,17S,18S)-7-methoxy-5,14-diazaheptacyclo[12.5.3.01,13.04,12.04,18.06,11.012,16]docosa-6(11),7,9-triene-17,18-diol (PubChem CID 132576285) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is (1R,4S,12R,13S,16R,17S,18S)-7-methoxy-5,14-diazaheptacyclo[12.5.3.01,13.04,12.04,18.06,11.012,16]docosa-6(11),7,9-triene-17,18-diol.
| Compound Name | (1R,4S,12R,13S,16R,17S,18S)-7-methoxy-5,14-diazaheptacyclo[12.5.3.01,13.04,12.04,18.06,11.012,16]docosa-6(11),7,9-triene-17,18-diol |
|---|---|
| PubChem CID | 132576285 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (1R,4S,12R,13S,16R,17S,18S)-7-methoxy-5,14-diazaheptacyclo[12.5.3.01,13.04,12.04,18.06,11.012,16]docosa-6(11),7,9-triene-17,18-diol |
| SMILES | COc1cccc2c1N[C@]13CC[C@]45CCCN6C[C@H]([C@H](O)[C@]1(O)C4)[C@]23[C@@H]65 |
| InChI | InChI=1S/C21H26N2O3/c1-26-14-5-2-4-12-15(14)22-20-8-7-18-6-3-9-23-10-13(21(12,20)17(18)23)16(24)19(20,25)11-18/h2,4-5,13,16-17,22,24-25H,3,6-11H2,1H3/t13-,16+,17+,18-,19-,20-,21+/m1/s1 |
| InChIKey | KEUKLLAPBHPCMX-FJWHAJLZSA-N |
| XLogP | 1.48 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |